CAS 898792-10-4

Methanone, (3-chloro-5-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its unique reactivity and potential biological activity. The morpholine moiety indicates that the compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its molecular structure suggests that it may possess lipophilic characteristics, which can influence its solubility and permeability in biological systems. Additionally, the specific arrangement of substituents may affect its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical and pharmaceutical applications.

Formula: C₁₈H₁₇ClFNO₂

InChI: InChI=1S/C18H17ClFNO2/c19-16-9-15(10-17(20)11-16)18(22)14-3-1-2-13(8-14)12-21-4-6-23-7-5-21/h1-3,8-11H,4-7,12H2

InChI key: InChIKey=XZCIVVFHOXTLGR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(F)=C1)C2=CC(CN3CCOCC3)=CC=C2

Synonyms:

• Methanone, (3-chloro-5-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-
• (3-Chloro-5-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]methanone
• 3-Chloro-5-fluoro-3′-morpholinomethyl benzophenone