CAS 898792-13-7

Methanone, (4-chloro-2-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-2-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The morpholine moiety suggests that the compound may exhibit certain pharmacological properties, as morpholine derivatives are often explored in medicinal chemistry for their ability to interact with biological targets. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its aromatic nature. Its molecular interactions may be influenced by hydrogen bonding and dipole-dipole interactions due to the presence of electronegative atoms. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks associated with toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₈H₁₇ClFNO₂

InChI: InChI=1S/C18H17ClFNO2/c19-15-4-5-16(17(20)11-15)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=GWMGCHVHLRZCFL-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(Cl)C=C1)C2=CC(CN3CCOCC3)=CC=C2

Synonyms:

• Methanone, (4-chloro-2-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-
• (4-Chloro-2-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]methanone

4-chloro-2-fluoro-3′-morpholinomethyl benzophenone

CAS: 898792-13-7

Formula: C₁₈H₁₇ClFNO₂

Purity: 97.0%

Molecular weight: 333.79

Ref: 10-F204692