CAS 898792-15-9
:4-(Hexyloxy)-η-oxobenzeneoctanoic acid
Description:
4-(Hexyloxy)-η-oxobenzeneoctanoic acid, identified by its CAS number 898792-15-9, is a chemical compound that features a complex structure combining both aromatic and aliphatic components. This substance contains a hexyloxy group, which contributes to its hydrophobic characteristics, enhancing its solubility in organic solvents. The presence of the η-oxo group indicates a ketone functionality, which can influence its reactivity and potential applications in organic synthesis or materials science. The octanoic acid moiety suggests that it may exhibit fatty acid-like properties, potentially impacting its behavior in biological systems or as a surfactant. Overall, this compound's unique combination of functional groups may allow for diverse applications, including use in pharmaceuticals, agrochemicals, or as intermediates in chemical synthesis. Its specific characteristics, such as melting point, boiling point, and reactivity, would require further investigation through experimental data or literature to fully understand its behavior in various chemical contexts.
Formula:C20H30O4
InChI:InChI=1S/C20H30O4/c1-2-3-4-9-16-24-18-14-12-17(13-15-18)19(21)10-7-5-6-8-11-20(22)23/h12-15H,2-11,16H2,1H3,(H,22,23)
InChI key:InChIKey=BHGLMAQDAQZSLD-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(=O)C1=CC=C(OCCCCCC)C=C1
Synonyms:- 4-(Hexyloxy)-η-oxobenzeneoctanoic acid
- Benzeneoctanoic acid, 4-(hexyloxy)-η-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.