CAS 898792-19-3

Methanone, (2,4-dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and physical properties. The 3-(4-morpholinylmethyl)phenyl moiety introduces a morpholine ring, a six-membered heterocyclic structure containing oxygen and nitrogen, which can enhance the compound's solubility and biological activity. This compound is likely to exhibit properties typical of both ketones and aromatic compounds, such as potential reactivity in electrophilic substitution reactions and interactions with biological targets. Its specific applications may vary, but compounds with similar structures are often investigated for pharmaceutical properties, including potential therapeutic effects. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of chlorine atoms, which can impart toxicity.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1S/C18H17Cl2NO2/c19-15-4-5-16(17(20)11-15)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=AJTDUSJBWDNPIX-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2=CC(CN3CCOCC3)=CC=C2

Synonyms:

• 2,4-Dichloro-3′-morpholinomethyl benzophenone
• (2,4-Dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]methanone
• Methanone, (2,4-dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]-

2,4-dichloro-3′-morpholinomethyl benzophenone

CAS: 898792-19-3

Formula: C₁₈H₁₇Cl₂NO₂

Purity: 97.0%

Molecular weight: 350.24

Ref: 10-F204694