CAS 898792-22-8

Methanone, (2,5-dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the dichlorophenyl group indicates that it has two chlorine substituents on the phenyl ring, which can influence its reactivity and physical properties. Additionally, the compound features a morpholine moiety, a six-membered ring containing both nitrogen and oxygen, which contributes to its potential biological activity and solubility characteristics. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability under various conditions and potential interactions with biological targets. Its specific applications may vary, but compounds with similar structures are often investigated for their pharmacological properties, including anti-cancer or anti-inflammatory activities. As with many organic compounds, its behavior in chemical reactions, solubility in solvents, and interaction with other molecules will depend on its functional groups and overall molecular architecture.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1S/C18H17Cl2NO2/c19-15-4-5-17(20)16(11-15)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=DXHKURVKQCMRLF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=C(Cl)C=CC(Cl)=C3

Synonyms:

• Methanone, (2,5-dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]-
• (2,5-Dichlorophenyl)[3-(4-morpholinylmethyl)phenyl]methanone
• 2,5-Dichloro-3′-morpholinomethyl benzophenone

2,5-dichloro-3′-morpholinomethyl benzophenone

CAS: 898792-22-8

Formula: C₁₈H₁₇Cl₂NO₂

Purity: 97.0%

Molecular weight: 350.24

Ref: 10-F204695