CAS 898792-24-0
:(3,4-dichlorophenyl)-[3-(morpholinomethyl)phenyl]methanone
Description:
(3,4-Dichlorophenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898792-24-0, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with aromatic ketones, including potential biological activity due to the presence of the morpholine moiety, which can enhance solubility and interaction with biological targets. It may display moderate to high lipophilicity, influencing its pharmacokinetic properties. The dichlorophenyl group can contribute to its electronic properties, potentially affecting reactivity and stability. As with many organic compounds, its solubility may vary in different solvents, and it may be sensitive to light or heat. Safety data should be consulted for handling and storage, as compounds with similar structures can exhibit toxicity or environmental hazards. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry or as a research tool in various chemical and biological studies.
Formula:C18H17Cl2NO2
InChI:InChI=1/C18H17Cl2NO2/c19-16-5-4-15(11-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(c(c1)Cl)Cl)CN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.