CAS 898792-26-2

(3,5-dichlorophenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(3,5-Dichlorophenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898792-26-2, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with aromatic ketones, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The dichlorophenyl moiety may impart specific electronic and steric effects, influencing its chemical behavior and interactions. Morpholine, a cyclic amine, contributes to the compound's potential biological activity, possibly enhancing its ability to interact with biological targets. The presence of chlorine atoms can also affect the compound's lipophilicity and overall pharmacokinetic properties. As with many synthetic compounds, its stability, reactivity, and potential applications in pharmaceuticals or agrochemicals would depend on the specific conditions under which it is used. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₁₈H₁₇Cl₂NO₂

InChI: InChI=1/C18H17Cl2NO2/c19-16-9-15(10-17(20)11-16)18(22)14-3-1-2-13(8-14)12-21-4-6-23-7-5-21/h1-3,8-11H,4-7,12H2

SMILES: c1cc(cc(c1)C(=O)c1cc(cc(c1)Cl)Cl)CN1CCOCC1