CAS 898792-29-5
:5-(2,3-dimethoxyphenyl)-5-oxo-pentanoic acid
Description:
5-(2,3-Dimethoxyphenyl)-5-oxo-pentanoic acid, with the CAS number 898792-29-5, is an organic compound characterized by its unique structure that includes a pentanoic acid backbone substituted with a 2,3-dimethoxyphenyl group. This compound features a ketone functional group (5-oxo) at the fifth carbon of the pentanoic acid chain, contributing to its reactivity and potential applications in organic synthesis. The presence of methoxy groups on the aromatic ring enhances its solubility in organic solvents and may influence its biological activity. The compound's molecular structure suggests potential uses in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Additionally, its properties, such as melting point, boiling point, and solubility, would be influenced by the substituents on the aromatic ring and the carboxylic acid functional group. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various fields, including medicinal chemistry and materials science.
Formula:C13H16O5
InChI:InChI=1/C13H16O5/c1-17-11-7-3-5-9(13(11)18-2)10(14)6-4-8-12(15)16/h3,5,7H,4,6,8H2,1-2H3,(H,15,16)
SMILES:COc1cccc(C(=O)CCCC(=O)O)c1OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.