CAS 898792-30-8

(3,4-difluorophenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(3,4-Difluorophenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898792-30-8, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and a morpholine moiety. This compound features a difluorophenyl group, which enhances its electronic properties and may influence its reactivity and biological activity. The presence of the morpholinomethyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as morpholine derivatives are often associated with various biological activities. The compound's molecular structure indicates it may exhibit lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the fluorine atoms can impart unique characteristics such as increased metabolic stability and altered binding interactions with biological targets. Overall, this compound's distinctive features make it a subject of interest in research, particularly in the fields of drug design and development.

Formula: C₁₈H₁₇F₂NO₂

InChI: InChI=1/C18H17F2NO2/c19-16-5-4-15(11-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

SMILES: c1cc(cc(c1)C(=O)c1ccc(c(c1)F)F)CN1CCOCC1