CymitQuimica logo

CAS 898792-31-9

:

2,3-Dimethoxy-ε-oxobenzenehexanoic acid

Description:
2,3-Dimethoxy-ε-oxobenzenehexanoic acid, identified by its CAS number 898792-31-9, is a chemical compound that features a benzene ring substituted with two methoxy groups and a hexanoic acid chain. The presence of the methoxy groups indicates that the compound has potential for various interactions, including hydrogen bonding and dipole-dipole interactions, which can influence its solubility and reactivity. The hexanoic acid moiety contributes to the compound's hydrophobic characteristics, while the oxo group introduces a carbonyl functionality that can participate in various chemical reactions, such as nucleophilic attacks. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features suggest potential applications in drug development or as a synthetic intermediate in organic chemistry. However, specific properties such as melting point, boiling point, and solubility would need to be determined through experimental methods or detailed literature review for practical applications.
Formula:C14H18O5
InChI:InChI=1S/C14H18O5/c1-18-12-8-5-6-10(14(12)19-2)11(15)7-3-4-9-13(16)17/h5-6,8H,3-4,7,9H2,1-2H3,(H,16,17)
InChI key:InChIKey=SUXHKLKUXVORJA-UHFFFAOYSA-N
SMILES:C(CCCCC(O)=O)(=O)C1=C(OC)C(OC)=CC=C1
Synonyms:
  • Benzenehexanoic acid, 2,3-dimethoxy-ε-oxo-
  • 2,3-Dimethoxy-ε-oxobenzenehexanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.