CAS 898792-42-2

Cyclohexyl[3-(4-morpholinylmethyl)phenyl]methanone

Description:

Cyclohexyl[3-(4-morpholinylmethyl)phenyl]methanone, identified by its CAS number 898792-42-2, is a chemical compound characterized by its unique structure that includes a cyclohexyl group and a phenyl ring substituted with a morpholinylmethyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents due to its hydrophobic cyclohexyl and phenyl components, while the morpholine moiety may impart some polar characteristics. The presence of the morpholine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as morpholine derivatives are often associated with biological activity. Additionally, the compound may exhibit moderate to high stability under standard conditions, but like many organic compounds, it should be handled with care to avoid exposure to heat, light, or reactive agents. Overall, its unique structure and functional groups make it a compound of interest in various chemical research fields.

Formula: C₁₈H₂₅NO₂

InChI: InChI=1S/C18H25NO2/c20-18(16-6-2-1-3-7-16)17-8-4-5-15(13-17)14-19-9-11-21-12-10-19/h4-5,8,13,16H,1-3,6-7,9-12,14H2

InChI key: InChIKey=PUDGGXAHYQUCBL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3CCCCC3

Synonyms:

• Cyclohexyl[3-(4-morpholinylmethyl)phenyl]methanone
• Methanone, cyclohexyl[3-(4-morpholinylmethyl)phenyl]-