CAS 898792-44-4
:Ethyl 3-(4-morpholinylmethyl)-γ-oxobenzenebutanoate
Description:
Ethyl 3-(4-morpholinylmethyl)-γ-oxobenzenebutanoate, identified by its CAS number 898792-44-4, is a chemical compound that features a complex structure incorporating both an ester and a morpholine moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is likely to be soluble in organic solvents, while its solubility in water may be limited due to the presence of hydrophobic aromatic and aliphatic components. The morpholine ring contributes to its potential biological activity, as morpholine derivatives are often associated with various pharmacological properties. The compound may also display moderate to high stability under standard conditions, although it could be sensitive to hydrolysis in the presence of strong acids or bases. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C17H23NO4
InChI:InChI=1S/C17H23NO4/c1-2-22-17(20)7-6-16(19)15-5-3-4-14(12-15)13-18-8-10-21-11-9-18/h3-5,12H,2,6-11,13H2,1H3
InChI key:InChIKey=REEIZVUHKJZQFP-UHFFFAOYSA-N
SMILES:C(C1=CC(C(CCC(OCC)=O)=O)=CC=C1)N2CCOCC2
Synonyms:- Benzenebutanoic acid, 3-(4-morpholinylmethyl)-γ-oxo-, ethyl ester
- Ethyl 3-(4-morpholinylmethyl)-γ-oxobenzenebutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.