CymitQuimica logo

CAS 898792-45-5

:

2,6-Dimethoxy-γ-oxobenzenebutanoic acid

Description:
2,6-Dimethoxy-γ-oxobenzenebutanoic acid, identified by its CAS number 898792-45-5, is a chemical compound that features a benzenebutanoic acid structure with two methoxy groups positioned at the 2 and 6 positions of the benzene ring. This compound is characterized by its functional groups, which include a carboxylic acid and a ketone, contributing to its reactivity and potential applications in organic synthesis. The presence of methoxy groups enhances its solubility in organic solvents and may influence its biological activity. Typically, compounds of this nature can exhibit various properties such as moderate to high melting points, depending on their molecular interactions and crystalline structure. Additionally, the compound may possess potential pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, 2,6-Dimethoxy-γ-oxobenzenebutanoic acid represents a versatile structure with implications in both research and application within the field of organic chemistry.
Formula:C12H14O5
InChI:InChI=1S/C12H14O5/c1-16-9-4-3-5-10(17-2)12(9)8(13)6-7-11(14)15/h3-5H,6-7H2,1-2H3,(H,14,15)
InChI key:InChIKey=SSGFEFAIKLRWNZ-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(=O)C1=C(OC)C=CC=C1OC
Synonyms:
  • Benzenebutanoic acid, 2,6-dimethoxy-γ-oxo-
  • 2,6-Dimethoxy-γ-oxobenzenebutanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.