CAS 898792-46-6
:Ethyl 3-(4-morpholinylmethyl)-δ-oxobenzenepentanoate
Description:
Ethyl 3-(4-morpholinylmethyl)-δ-oxobenzenepentanoate, identified by its CAS number 898792-46-6, is a chemical compound that features a complex structure incorporating both an ester and a morpholine moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. Its molecular structure suggests it may possess moderate solubility in organic solvents, while its solubility in water could be limited due to the presence of hydrophobic aromatic and aliphatic components. The morpholine ring contributes to its potential biological activity, possibly influencing its interaction with biological systems. Ethyl 3-(4-morpholinylmethyl)-δ-oxobenzenepentanoate may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. However, specific data regarding its reactivity, stability, and toxicity would require further investigation through empirical studies and safety assessments. As with any chemical substance, proper handling and safety protocols should be observed when working with this compound.
Formula:C18H25NO4
InChI:InChI=1S/C18H25NO4/c1-2-23-18(21)8-4-7-17(20)16-6-3-5-15(13-16)14-19-9-11-22-12-10-19/h3,5-6,13H,2,4,7-12,14H2,1H3
InChI key:InChIKey=MNGKFBYWBMRIIS-UHFFFAOYSA-N
SMILES:C(C1=CC(C(CCCC(OCC)=O)=O)=CC=C1)N2CCOCC2
Synonyms:- Benzenepentanoic acid, 3-(4-morpholinylmethyl)-δ-oxo-, ethyl ester
- Ethyl 3-(4-morpholinylmethyl)-δ-oxobenzenepentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.