CAS 898792-50-2

Ethyl 3-(4-morpholinylmethyl)-ζ-oxobenzeneheptanoate

Description:

Ethyl 3-(4-morpholinylmethyl)-ζ-oxobenzeneheptanoate, identified by its CAS number 898792-50-2, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group and a morpholine moiety. This compound typically exhibits properties associated with esters, such as being a liquid at room temperature with potential solubility in organic solvents. The presence of the morpholine ring suggests it may have basic properties and could participate in hydrogen bonding due to the nitrogen atom in the ring. The oxobenzene component indicates the presence of a carbonyl group adjacent to an aromatic system, which may contribute to its reactivity and potential applications in medicinal chemistry or as an intermediate in organic synthesis. Additionally, the heptanoate chain may influence its lipophilicity, affecting its biological activity and interaction with cellular membranes. Overall, this compound's unique structural features may lend it specific functionalities in various chemical and pharmaceutical applications.

Formula: C₂₀H₂₉NO₄

InChI: InChI=1S/C20H29NO4/c1-2-25-20(23)10-5-3-4-9-19(22)18-8-6-7-17(15-18)16-21-11-13-24-14-12-21/h6-8,15H,2-5,9-14,16H2,1H3

InChI key: InChIKey=CRESNUNBHUWNJA-UHFFFAOYSA-N

SMILES: C(C1=CC(C(CCCCCC(OCC)=O)=O)=CC=C1)N2CCOCC2

Synonyms:

• Benzeneheptanoic acid, 3-(4-morpholinylmethyl)-ζ-oxo-, ethyl ester
• Ethyl 3-(4-morpholinylmethyl)-ζ-oxobenzeneheptanoate

ethyl 7-[3-(morpholinomethyl)phenyl]-7-oxoheptanoate

CAS: 898792-50-2

Formula: C₂₀H₂₉NO₄

Purity: 97.0%

Molecular weight: 347.455

Ref: 10-F204709