CAS 898792-52-4

Ethyl 3-(4-morpholinylmethyl)-η-oxobenzeneoctanoate

Description:

Ethyl 3-(4-morpholinylmethyl)-η-oxobenzeneoctanoate, identified by its CAS number 898792-52-4, is a chemical compound that features a complex structure incorporating an ethyl ester group, a morpholine moiety, and a benzene ring with an oxo functional group. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the morpholine ring, which is often associated with biological activity. The ethyl ester component contributes to its solubility and reactivity, making it suitable for various chemical reactions. The presence of the octanoate chain may enhance lipophilicity, influencing its pharmacokinetic properties. Additionally, the compound's unique structural features may allow for specific interactions with biological targets, which is essential for its efficacy in therapeutic applications. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₂₁H₃₁NO₄

InChI: InChI=1S/C21H31NO4/c1-2-26-21(24)11-6-4-3-5-10-20(23)19-9-7-8-18(16-19)17-22-12-14-25-15-13-22/h7-9,16H,2-6,10-15,17H2,1H3

InChI key: InChIKey=CQMBFDCORZGMFK-UHFFFAOYSA-N

SMILES: C(C1=CC(C(CCCCCCC(OCC)=O)=O)=CC=C1)N2CCOCC2

Synonyms:

• Benzeneoctanoic acid, 3-(4-morpholinylmethyl)-η-oxo-, ethyl ester
• Ethyl 3-(4-morpholinylmethyl)-η-oxobenzeneoctanoate

ethyl 8-[3-(morpholinomethyl)phenyl]-4-oxooctanoate

CAS: 898792-52-4

Formula: C₂₁H₃₁NO₄

Purity: 97.0%

Molecular weight: 361.482

Ref: 10-F204710