CAS 898792-56-8

Methanone, (2-methylphenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2-methylphenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals. This compound features a 2-methylphenyl group and a 3-(1-piperidinylmethyl)phenyl group, indicating that it has both hydrophobic and potentially polar characteristics due to the presence of nitrogen in the piperidine ring. The molecular structure likely contributes to its solubility properties, which may vary depending on the solvent used. Additionally, the compound's specific stereochemistry and substituent positions can influence its reactivity and interactions with biological targets. As with many organic compounds, it is essential to consider safety and handling protocols, as well as potential applications in medicinal chemistry or material science, when working with or studying this substance.

Formula: C₂₀H₂₃NO

InChI: InChI=1S/C20H23NO/c1-16-8-3-4-11-19(16)20(22)18-10-7-9-17(14-18)15-21-12-5-2-6-13-21/h3-4,7-11,14H,2,5-6,12-13,15H2,1H3

InChI key: InChIKey=KFGAYXMRSHKKLJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=C(C)C=CC=C3

Synonyms:

• 2-Methyl-3′-piperidinomethyl benzophenone
• Methanone, (2-methylphenyl)[3-(1-piperidinylmethyl)phenyl]-
• (2-Methylphenyl)[3-(1-piperidinylmethyl)phenyl]methanone