CymitQuimica logo

CAS 898792-57-9

:

8-(3,5-dimethoxyphenyl)-8-oxo-octanoic acid

Description:
8-(3,5-Dimethoxyphenyl)-8-oxo-octanoic acid, with the CAS number 898792-57-9, is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone substituted with a phenyl group that has two methoxy groups at the 3 and 5 positions. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, including potential lipophilicity due to the long carbon chain and the presence of the aromatic ring. The oxo group at the 8-position contributes to its reactivity and may influence its biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or anticancer agents, due to their ability to interact with biological targets. Additionally, the presence of methoxy groups can enhance solubility and stability, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the intersection of fatty acid chemistry and aromatic compound functionality.
Formula:C16H22O5
InChI:InChI=1/C16H22O5/c1-20-13-9-12(10-14(11-13)21-2)15(17)7-5-3-4-6-8-16(18)19/h9-11H,3-8H2,1-2H3,(H,18,19)
SMILES:COc1cc(cc(c1)OC)C(=O)CCCCCCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.