CAS 898792-58-0

Methanone, (3-methylphenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (3-methylphenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a piperidinylmethyl group indicates that it has a nitrogen-containing heterocyclic component, contributing to its potential biological activity. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and having a relatively high boiling point compared to non-polar compounds. The aromatic rings suggest that it may have significant stability and potential for π-π interactions, which can influence its solubility and reactivity. Additionally, the presence of the piperidine moiety may impart basicity and influence its interaction with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structure may lead to diverse applications, particularly in pharmaceuticals, where it could serve as a lead compound for drug development.

Formula: C₂₀H₂₃NO

InChI: InChI=1/C20H23NO/c1-16-7-5-9-18(13-16)20(22)19-10-6-8-17(14-19)15-21-11-3-2-4-12-21/h5-10,13-14H,2-4,11-12,15H2,1H3

InChI key: InChIKey=QSXOWDMSOZCQJX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=CC(C)=CC=C3

Synonyms:

• Methanone, (3-methylphenyl)[3-(1-piperidinylmethyl)phenyl]-
• (3-Methylphenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• 3-Methyl-3′-piperidinomethyl benzophenone
• (3-(Piperidin-1-ylmethyl)phenyl)(m-tolyl)methanone