CAS 898792-60-4

Methanone, (4-methylphenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-methylphenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a piperidinylmethyl substituent indicates that it has a nitrogen-containing heterocyclic component, contributing to its potential biological activity. This compound is likely to exhibit properties typical of ketones, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The aromatic rings suggest that it may have significant stability and could engage in π-π stacking interactions, which are important in biological systems. Additionally, the presence of the piperidine ring may impart basicity and influence solubility in different solvents. Overall, this compound's unique structure may make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential applications.

Formula: C₂₀H₂₃NO

InChI: InChI=1S/C20H23NO/c1-16-8-10-18(11-9-16)20(22)19-7-5-6-17(14-19)15-21-12-3-2-4-13-21/h5-11,14H,2-4,12-13,15H2,1H3

InChI key: InChIKey=RKACTBIRTRMQLF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=CC=C(C)C=C3

Synonyms:

• 4′-Methyl-3-piperidinomethyl benzophenone
• (4-Methylphenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (4-methylphenyl)[3-(1-piperidinylmethyl)phenyl]-

4′-methyl-3-piperidinomethyl benzophenone

CAS: 898792-60-4

Formula: C₂₀H₂₃NO

Purity: 97.0%

Molecular weight: 293.41

Ref: 10-F204714