CymitQuimica logo

CAS 898792-62-6

:

(2-methoxyphenyl)-[3-(1-piperidylmethyl)phenyl]methanone

Description:
The chemical substance known as (2-methoxyphenyl)-[3-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898792-62-6, is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a methoxy group on one of the phenyl rings enhances its solubility in organic solvents and may influence its reactivity and biological activity. The piperidylmethyl substituent introduces a nitrogen-containing heterocycle, which can contribute to the compound's pharmacological properties, potentially affecting its interaction with biological targets. This compound may exhibit various properties such as lipophilicity, which is influenced by the aromatic and aliphatic components of its structure. Additionally, its molecular configuration suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed literature references for comprehensive characterization.
Formula:C20H23NO2
InChI:InChI=1/C20H23NO2/c1-23-19-11-4-3-10-18(19)20(22)17-9-7-8-16(14-17)15-21-12-5-2-6-13-21/h3-4,7-11,14H,2,5-6,12-13,15H2,1H3
SMILES:COc1ccccc1C(=O)c1cccc(c1)CN1CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.