CymitQuimica logo

CAS 898792-63-7

:

2-Chloro-ζ-oxobenzeneheptanoic acid

Description:
2-Chloro-ζ-oxobenzeneheptanoic acid, identified by its CAS number 898792-63-7, is a chemical compound that features a unique structure combining a chlorinated aromatic ring with a heptanoic acid chain. This compound typically exhibits characteristics associated with both aromatic and aliphatic compounds, including potential hydrophobicity due to the long carbon chain and reactivity due to the presence of the chlorine atom and the carboxylic acid functional group. The chlorinated aromatic component may impart specific electronic properties, influencing its reactivity and interactions with other molecules. Additionally, the presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may serve as a ligand in coordination chemistry. The compound's potential applications could span various fields, including pharmaceuticals, agrochemicals, and materials science, depending on its specific reactivity and biological activity. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C13H15ClO3
InChI:InChI=1S/C13H15ClO3/c14-11-7-5-4-6-10(11)12(15)8-2-1-3-9-13(16)17/h4-7H,1-3,8-9H2,(H,16,17)
InChI key:InChIKey=JCLWUQDRQZUEGO-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)(=O)C1=C(Cl)C=CC=C1
Synonyms:
  • Benzeneheptanoic acid, 2-chloro-ζ-oxo-
  • 2-Chloro-ζ-oxobenzeneheptanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.