CAS 898792-64-8

(3-methoxyphenyl)-[3-(1-piperidylmethyl)phenyl]methanone

Description:

(3-methoxyphenyl)-[3-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898792-64-8, is a synthetic organic compound characterized by its complex structure, which includes a methoxy group and a piperidine moiety. This compound typically exhibits properties associated with ketones, such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to be soluble in organic solvents due to its aromatic and aliphatic components, while its solubility in water may be limited. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The methoxy group can influence the compound's electronic properties and reactivity, potentially affecting its interactions in biological systems. As with many synthetic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a class of substances that may have applications in pharmaceuticals or as intermediates in organic synthesis.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1/C20H23NO2/c1-23-19-10-6-9-18(14-19)20(22)17-8-5-7-16(13-17)15-21-11-3-2-4-12-21/h5-10,13-14H,2-4,11-12,15H2,1H3

SMILES: COc1cccc(c1)C(=O)c1cccc(c1)CN1CCCCC1

3-methoxy-3′-piperidinomethyl benzophenone

CAS: 898792-64-8

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F204716