CAS 898792-66-0

Methanone, (4-methoxyphenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (4-methoxyphenyl)[3-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The methoxy group on one of the phenyl rings enhances the compound's lipophilicity, which can influence its biological activity and solubility. This compound may exhibit various properties such as being a potential ligand for biological targets, and its structure could suggest interactions with neurotransmitter systems. The specific arrangement of substituents can affect its reactivity and stability, making it of interest in synthetic organic chemistry. Additionally, the compound's CAS number, 898792-66-0, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, this compound represents a class of organic molecules that may have significant implications in pharmacology and material science.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-23-19-10-8-17(9-11-19)20(22)18-7-5-6-16(14-18)15-21-12-3-2-4-13-21/h5-11,14H,2-4,12-13,15H2,1H3

InChI key: InChIKey=GDPRKFPGCXGJNX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=CC=C(OC)C=C3

Synonyms:

• Methanone, (4-methoxyphenyl)[3-(1-piperidinylmethyl)phenyl]-
• (4-Methoxyphenyl)[3-(1-piperidinylmethyl)phenyl]methanone

4′-methoxy-3-piperidinomethyl benzophenone

CAS: 898792-66-0

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F204717