CAS 898792-68-2
:2-[3-(1-Piperidinylmethyl)benzoyl]benzonitrile
Description:
2-[3-(1-Piperidinylmethyl)benzoyl]benzonitrile, with the CAS number 898792-68-2, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzoyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of multiple functional groups. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The piperidine moiety may contribute to its biological activity, potentially influencing its interaction with various biological targets. Additionally, the presence of the nitrile group can enhance its reactivity and solubility in organic solvents. As with many compounds of this nature, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C20H20N2O
InChI:InChI=1S/C20H20N2O/c21-14-18-8-2-3-10-19(18)20(23)17-9-6-7-16(13-17)15-22-11-4-1-5-12-22/h2-3,6-10,13H,1,4-5,11-12,15H2
InChI key:InChIKey=FGFMYQRTSBKVOK-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C#N)C=CC=C1)C2=CC(CN3CCCCC3)=CC=C2
Synonyms:- Benzonitrile, 2-[3-(1-piperidinylmethyl)benzoyl]-
- 2-[3-(1-Piperidinylmethyl)benzoyl]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.