CymitQuimica logo

CAS 898792-74-0

:

1-Propanone, 3-(2,3-dimethylphenyl)-1-(2,4-dimethylphenyl)-

Description:
1-Propanone, 3-(2,3-dimethylphenyl)-1-(2,4-dimethylphenyl)-, also known by its CAS number 898792-74-0, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 2,4-dimethylphenyl group. The presence of these bulky aromatic rings contributes to its unique physical and chemical properties, including potential steric hindrance and varying solubility in organic solvents. Typically, compounds of this nature exhibit moderate volatility and can participate in various chemical reactions, such as nucleophilic additions or substitutions, due to the electrophilic nature of the carbonyl carbon. Additionally, the compound may display interesting optical properties and could be utilized in fields such as organic synthesis, materials science, or pharmaceuticals. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C19H22O
InChI:InChI=1S/C19H22O/c1-13-8-10-18(15(3)12-13)19(20)11-9-17-7-5-6-14(2)16(17)4/h5-8,10,12H,9,11H2,1-4H3
InChI key:InChIKey=DFWHZWAOPNKVQE-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(C)C=C(C)C=C1)C2=C(C)C(C)=CC=C2
Synonyms:
  • 1-Propanone, 3-(2,3-dimethylphenyl)-1-(2,4-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.