CAS 898792-75-1

ethyl 2-[3-(1-piperidylmethyl)benzoyl]benzoate

Description:

Ethyl 2-[3-(1-piperidylmethyl)benzoyl]benzoate, identified by its CAS number 898792-75-1, is a chemical compound that belongs to the class of esters. It features a benzoate moiety, which is characterized by the presence of a benzene ring attached to a carbonyl group (C=O) and an ethyl group. The compound also contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, indicating potential biological activity due to the presence of the piperidyl group. This structure suggests that the compound may exhibit properties relevant to medicinal chemistry, possibly acting as a pharmacophore in drug development. Ethyl 2-[3-(1-piperidylmethyl)benzoyl]benzoate may be synthesized through esterification reactions and could be of interest in various applications, including pharmaceuticals and organic synthesis. Its specific physical and chemical properties, such as solubility, melting point, and reactivity, would typically be determined through experimental methods and could vary based on the conditions of synthesis and storage.

Formula: C₂₂H₂₅NO₃

InChI: InChI=1/C22H25NO3/c1-2-26-22(25)20-12-5-4-11-19(20)21(24)18-10-8-9-17(15-18)16-23-13-6-3-7-14-23/h4-5,8-12,15H,2-3,6-7,13-14,16H2,1H3

SMILES: CCOC(=O)c1ccccc1C(=O)c1cccc(c1)CN1CCCCC1