CymitQuimica logo

CAS 898792-77-3

:

3-(2,3-dimethylphenyl)-1-(2,5-dimethylphenyl)propan-1-one

Description:
3-(2,3-Dimethylphenyl)-1-(2,5-dimethylphenyl)propan-1-one, identified by its CAS number 898792-77-3, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two substituted phenyl groups, each containing additional methyl groups, which contribute to its overall hydrophobic character and influence its physical properties. The presence of multiple methyl groups enhances its steric bulk and can affect its reactivity and interaction with other molecules. Typically, compounds of this nature may exhibit moderate to low solubility in water but are more soluble in organic solvents. The compound may also possess interesting optical properties due to its structural configuration, making it potentially useful in various applications, including organic synthesis and materials science. Additionally, its unique structure may allow for specific interactions in biological systems, warranting further investigation into its potential pharmacological properties. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-8-9-15(3)18(12-13)19(20)11-10-17-7-5-6-14(2)16(17)4/h5-9,12H,10-11H2,1-4H3
SMILES:Cc1ccc(C)c(c1)C(=O)CCc1cccc(C)c1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.