CAS 898792-86-4
:3-(2,3-dimethylphenyl)-1-(3,5-dimethylphenyl)propan-1-one
Description:
3-(2,3-Dimethylphenyl)-1-(3,5-dimethylphenyl)propan-1-one, identified by its CAS number 898792-86-4, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two aromatic substituents, specifically dimethylphenyl groups, which contribute to its unique chemical properties. The presence of multiple methyl groups on the phenyl rings enhances its hydrophobic character and may influence its reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit moderate to high melting and boiling points due to the presence of strong van der Waals forces between the aromatic rings. Additionally, the compound may demonstrate interesting biological activities, making it of interest in various fields, including pharmaceuticals and materials science. Its synthesis often involves standard organic reactions such as Friedel-Crafts acylation or similar methods. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-10-14(2)12-18(11-13)19(20)9-8-17-7-5-6-15(3)16(17)4/h5-7,10-12H,8-9H2,1-4H3
SMILES:Cc1cc(C)cc(c1)C(=O)CCc1cccc(C)c1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.