CAS 898792-89-7

1-(4-bromo-3-fluoro-phenyl)-3-(2,3-dimethylphenyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898792-89-7, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl group substituted with both a bromine and a fluorine atom, which can influence its reactivity and physical properties. The presence of the 2,3-dimethylphenyl group adds steric hindrance and may affect the compound's solubility and interaction with biological systems. Typically, compounds of this nature exhibit properties such as moderate to high lipophilicity due to their aromatic components, which can impact their behavior in various chemical environments. Additionally, the halogen substituents can enhance the compound's reactivity in electrophilic aromatic substitution reactions. The compound may also exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Overall, its unique structural features contribute to its potential applications in pharmaceuticals and materials science.

Formula: C₁₇H₁₆BrFO

InChI: InChI=1/C17H16BrFO/c1-11-4-3-5-13(12(11)2)7-9-17(20)14-6-8-15(18)16(19)10-14/h3-6,8,10H,7,9H2,1-2H3

SMILES: Cc1cccc(CCC(=O)c2ccc(c(c2)F)Br)c1C

4′-bromo-3-(2,3-dimethylphenyl)-3′-fluoropropiophenone

CAS: 898792-89-7

Formula: C₁₇H₁₆BrFO

Purity: 97.0%

Molecular weight: 335.216

Ref: 10-F206386