CAS 898792-90-0

(3-bromophenyl)-[3-(1-piperidylmethyl)phenyl]methanone

Description:

(3-bromophenyl)-[3-(1-piperidylmethyl)phenyl]methanone, with the CAS number 898792-90-0, is a chemical compound characterized by its complex structure that includes a bromophenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and lipophilicity. The piperidine ring adds a nitrogen atom, which may enhance solubility in polar solvents and facilitate interactions with biological targets. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, possibly acting as a ligand for various receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, including nucleophilic substitution and possibly coupling reactions. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the bromine atom, which can pose health risks.

Formula: C₁₉H₂₀BrNO

InChI: InChI=1/C19H20BrNO/c20-18-9-5-8-17(13-18)19(22)16-7-4-6-15(12-16)14-21-10-2-1-3-11-21/h4-9,12-13H,1-3,10-11,14H2

SMILES: C1CCN(CC1)Cc1cccc(c1)C(=O)c1cccc(c1)Br

3-bromo-3′-piperidinomethyl benzophenone

CAS: 898792-90-0

Formula: C₁₉H₂₀BrNO

Purity: 97.0%

Molecular weight: 358.279

Ref: 10-F204726