CAS 898792-92-2

1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-(2,3-dimethylphenyl)-

Description:

1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-(2,3-dimethylphenyl)-, also known by its CAS number 898792-92-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with substituents that include a 4-chloro-3-fluorophenyl group and a 2,3-dimethylphenyl group, contributing to its unique chemical properties. The presence of halogen atoms, such as chlorine and fluorine, often enhances the compound's reactivity and can influence its physical properties, including boiling and melting points. The compound is likely to be a solid at room temperature, given the presence of bulky aromatic groups, which can also affect its solubility in various solvents. Additionally, the molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such substituted ketones may exhibit biological activity. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1S/C17H16ClFO/c1-11-4-3-5-13(12(11)2)7-9-17(20)14-6-8-15(18)16(19)10-14/h3-6,8,10H,7,9H2,1-2H3

InChI key: InChIKey=XMHUUGRSQHMQFQ-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C(C)=CC=C1)(=O)C2=CC(F)=C(Cl)C=C2

Synonyms:

• 4′-Chloro-3-(2,3-dimethylphenyl)-3′-fluoropropiophenone
• 1-(4-Chloro-3-fluorophenyl)-3-(2,3-dimethylphenyl)-1-propanone
• 1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-(2,3-dimethylphenyl)-