CAS 898792-94-4
:ethyl 5-[3,5-bis(trifluoromethyl)phenyl]-5-oxo-pentanoate
Description:
Ethyl 5-[3,5-bis(trifluoromethyl)phenyl]-5-oxo-pentanoate is an organic compound characterized by its ester functional group and a complex aromatic structure. The presence of the trifluoromethyl groups on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially altering its reactivity and biological activity. The compound features a pentanoate chain, which contributes to its overall molecular structure and may affect its solubility and volatility. Typically, such compounds are of interest in various fields, including pharmaceuticals and agrochemicals, due to their potential applications as intermediates or active ingredients. The trifluoromethyl groups can impart unique electronic properties, making the compound a subject of study in medicinal chemistry for developing new therapeutic agents. Additionally, the compound's stability, reactivity, and interactions with biological systems can be influenced by the presence of these fluorinated groups, which are known to enhance metabolic stability in drug design. Overall, ethyl 5-[3,5-bis(trifluoromethyl)phenyl]-5-oxo-pentanoate exemplifies the complexity and utility of fluorinated organic compounds in modern chemistry.
Formula:C15H14F6O3
InChI:InChI=1/C15H14F6O3/c1-2-24-13(23)5-3-4-12(22)9-6-10(14(16,17)18)8-11(7-9)15(19,20)21/h6-8H,2-5H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.