CAS 898792-96-6

(3-chlorophenyl)-[3-(1-piperidylmethyl)phenyl]methanone

Description:

(3-chlorophenyl)-[3-(1-piperidylmethyl)phenyl]methanone, identified by its CAS number 898792-96-6, is a chemical compound characterized by its complex structure, which includes a chlorophenyl group and a piperidylmethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chlorophenyl moiety may influence its lipophilicity and reactivity, while the piperidine ring can impart basicity and steric effects. Such structural features suggest that it may interact with various biological targets, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for pharmacological properties in drug discovery contexts. As with many compounds of this nature, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₉H₂₀ClNO

InChI: InChI=1/C19H20ClNO/c20-18-9-5-8-17(13-18)19(22)16-7-4-6-15(12-16)14-21-10-2-1-3-11-21/h4-9,12-13H,1-3,10-11,14H2

SMILES: C1CCN(CC1)Cc1cccc(c1)C(=O)c1cccc(c1)Cl

3-chloro-3′-piperidinomethyl benzophenone

CAS: 898792-96-6

Formula: C₁₉H₂₀ClNO

Purity: 97.0%

Molecular weight: 313.83

Ref: 10-F204728