CAS 898793-00-5
:ethyl 7-[3,5-bis(trifluoromethyl)phenyl]-7-oxo-heptanoate
Description:
Ethyl 7-[3,5-bis(trifluoromethyl)phenyl]-7-oxo-heptanoate, identified by its CAS number 898793-00-5, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group and a heptanoate backbone. The presence of the 3,5-bis(trifluoromethyl)phenyl group imparts significant lipophilicity and potential biological activity, making it of interest in pharmaceutical research. This compound typically exhibits a high degree of stability due to the presence of the carbonyl group, which can participate in various chemical reactions, including nucleophilic attacks. Its trifluoromethyl groups enhance its electron-withdrawing properties, influencing its reactivity and solubility in organic solvents. Ethyl 7-[3,5-bis(trifluoromethyl)phenyl]-7-oxo-heptanoate may also display interesting interactions with biological targets, which could be explored for therapeutic applications. Overall, its unique structural features suggest potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C17H18F6O3
InChI:InChI=1/C17H18F6O3/c1-2-26-15(25)7-5-3-4-6-14(24)11-8-12(16(18,19)20)10-13(9-11)17(21,22)23/h8-10H,2-7H2,1H3
SMILES:CCOC(=O)CCCCCC(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.