CAS 898793-02-7
:Methanone, (3-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-
Description:
Methanone, (3-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two phenyl rings, one of which is substituted with a fluorine atom. The presence of a piperidinylmethyl group indicates that it has a piperidine ring, which is a six-membered nitrogen-containing heterocycle, contributing to its potential biological activity. This compound may exhibit properties typical of both aromatic and aliphatic systems, influencing its reactivity and interactions with biological targets. The fluorine substitution can enhance lipophilicity and metabolic stability, potentially affecting its pharmacokinetic properties. Methanone derivatives often serve as intermediates in organic synthesis and may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as solubility, melting point, and reactivity, would depend on the overall molecular structure and the presence of functional groups. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C19H20FNO
InChI:InChI=1/C19H20FNO/c20-18-9-5-8-17(13-18)19(22)16-7-4-6-15(12-16)14-21-10-2-1-3-11-21/h4-9,12-13H,1-3,10-11,14H2
InChI key:InChIKey=DVHVOCYNZZGSIR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=CC(F)=CC=C3
Synonyms:- (3-Fluorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone
- Methanone, (3-fluorophenyl)[3-(1-piperidinylmethyl)phenyl]-
- 3-Fluoro-3′-piperidinomethyl benzophenone
- (3-Fluorophenyl)(3-(piperidin-1-ylmethyl)phenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.