CAS 898793-04-9

1-Propanone, 3-(2,3-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(2,3-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 2-(trifluoromethyl)phenyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its reactivity and interactions in various chemical environments. The molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's unique substituents may impart specific physical properties, such as boiling point and solubility, which are important for its practical applications. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorinated groups, which can exhibit unique environmental and health impacts.

Formula: C₁₈H₁₇F₃O

InChI: InChI=1S/C18H17F3O/c1-12-6-5-7-14(13(12)2)10-11-17(22)15-8-3-4-9-16(15)18(19,20)21/h3-9H,10-11H2,1-2H3

InChI key: InChIKey=ZDABXUXHCMKKGN-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C(C)=CC=C1)(=O)C2=C(C(F)(F)F)C=CC=C2

Synonyms:

• 3-(2,3-Dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]-1-propanone
• 1-Propanone, 3-(2,3-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]-