CymitQuimica logo

CAS 898793-07-2

:

3-(2,3-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one

Description:
3-(2,3-Dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one, identified by its CAS number 898793-07-2, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains two distinct aromatic rings: one with a trifluoromethyl group, which enhances its electron-withdrawing properties, and another with two methyl substituents that can influence its steric and electronic characteristics. The presence of these functional groups suggests that the compound may exhibit interesting chemical reactivity and potential applications in fields such as pharmaceuticals or materials science. Its molecular structure indicates that it may have specific interactions with biological targets or could serve as a precursor in synthetic pathways. Additionally, the trifluoromethyl group is known to impart unique properties, such as increased lipophilicity and metabolic stability, which can be advantageous in drug design. Overall, this compound's unique combination of substituents contributes to its potential utility in various chemical applications.
Formula:C18H17F3O
InChI:InChI=1/C18H17F3O/c1-12-5-3-6-14(13(12)2)9-10-17(22)15-7-4-8-16(11-15)18(19,20)21/h3-8,11H,9-10H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2cccc(c2)C(F)(F)F)c1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.