CAS 898793-08-3

(2,3-Dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]methanone

Description:

(2,3-Dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]methanone, with the CAS number 898793-08-3, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a piperidinylmethyl group attached to another phenyl ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Additionally, the compound's unique arrangement of functional groups may impart specific reactivity and stability characteristics, which are essential for its application in research or pharmaceutical development. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₂₁H₂₅NO

InChI: InChI=1S/C21H25NO/c1-16-8-6-11-20(17(16)2)21(23)19-10-7-9-18(14-19)15-22-12-4-3-5-13-22/h6-11,14H,3-5,12-13,15H2,1-2H3

InChI key: InChIKey=FHIQJOWGIKARCW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=C(C)C(C)=CC=C3

Synonyms:

• (2,3-Dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• Methanone, (2,3-dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]-
• 2,3-Dimethyl-3′-piperidinomethyl benzophenone