CAS 898793-10-7

1-Propanone, 3-(2,3-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(2,3-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 4-trifluoromethylphenyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and interactions with biological systems. The compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. Its molecular structure suggests it may exhibit interesting properties such as polarity and solubility in organic solvents. Additionally, the presence of multiple aromatic rings may contribute to its stability and potential applications in various fields, including pharmaceuticals and materials science. As with many organic compounds, safety data should be consulted to understand its handling and toxicity.

Formula: C₁₈H₁₇F₃O

InChI: InChI=1/C18H17F3O/c1-12-4-3-5-14(13(12)2)8-11-17(22)15-6-9-16(10-7-15)18(19,20)21/h3-7,9-10H,8,11H2,1-2H3

InChI key: InChIKey=QADFGZBHOONBML-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C(C)=CC=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 3-(2,3-Dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone
• 1-Propanone, 3-(2,3-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]-
• 3-(2,3-Dimethylphenyl)-4′-trifluoromethyl-propiophenone

3-(2,3-dimethylphenyl)-4′-trifluoromethylpropiophenone

CAS: 898793-10-7

Formula: C₁₈H₁₇F₃O

Purity: 97.0%

Molecular weight: 306.328

Ref: 10-F206393