CAS 898793-12-9
:ethyl 7-(3,4-dimethylphenyl)-7-oxo-heptanoate
Description:
Ethyl 7-(3,4-dimethylphenyl)-7-oxo-heptanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. The structure features a heptanoate backbone, indicating a seven-carbon chain, with a ketone group at the seventh position and a phenyl substituent that has two methyl groups at the 3 and 4 positions. This compound is likely to exhibit moderate lipophilicity due to its hydrophobic hydrocarbon chain and aromatic ring, which can influence its solubility in organic solvents. The presence of the ketone and ester functionalities may also impart specific reactivity, making it a potential candidate for various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, the compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific biological activities or uses would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C17H24O3
InChI:InChI=1/C17H24O3/c1-4-20-17(19)9-7-5-6-8-16(18)15-11-10-13(2)14(3)12-15/h10-12H,4-9H2,1-3H3
SMILES:CCOC(=O)CCCCCC(=O)c1ccc(C)c(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.