CAS 898793-13-0

1-(4-bromo-2-fluoro-phenyl)-3-(2,3-dimethylphenyl)propan-1-one

Description:

1-(4-bromo-2-fluoro-phenyl)-3-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898793-13-0, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a bromo and a fluoro group on the phenyl rings. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogen atoms (bromine and fluorine) often enhances the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. Additionally, the dimethyl substitution on one of the phenyl rings can influence the steric and electronic properties of the molecule, potentially affecting its interactions with biological targets. The compound may exhibit unique physical properties, such as solubility and melting point, influenced by its molecular structure. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and materials science.

Formula: C₁₇H₁₆BrFO

InChI: InChI=1/C17H16BrFO/c1-11-4-3-5-13(12(11)2)6-9-17(20)15-8-7-14(18)10-16(15)19/h3-5,7-8,10H,6,9H2,1-2H3

SMILES: Cc1cccc(CCC(=O)c2ccc(cc2F)Br)c1C

4′-bromo-3-(2,3-dimethylphenyl)-2′-fluoropropiophenone

CAS: 898793-13-0

Formula: C₁₇H₁₆BrFO

Purity: 97.0%

Molecular weight: 335.216

Ref: 10-F206394