CAS 898793-16-3

1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(2,3-dimethylphenyl)-

Description:

1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(2,3-dimethylphenyl)-, also known by its CAS number 898793-16-3, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2-chloro-4-fluorophenyl group and a 2,3-dimethylphenyl group. The presence of chlorine and fluorine atoms in the aromatic ring contributes to its unique chemical properties, potentially influencing its reactivity and interaction with biological systems. The compound is likely to exhibit moderate polarity due to the electronegative halogen substituents, which can affect its solubility in various solvents. Additionally, the steric hindrance introduced by the dimethyl groups may influence its conformational stability and reactivity. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Its specific applications and behavior in chemical reactions would depend on further empirical studies and characterization.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1S/C17H16ClFO/c1-11-4-3-5-13(12(11)2)6-9-17(20)15-8-7-14(19)10-16(15)18/h3-5,7-8,10H,6,9H2,1-2H3

InChI key: InChIKey=UXFMAMDFNXHCTH-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(Cl)C=C(F)C=C1)C2=C(C)C(C)=CC=C2

Synonyms:

• 2′-Chloro-3-(2,3-dimethylphenyl)-4′-fluoropropiophenone
• 1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(2,3-dimethylphenyl)-