CAS 898793-17-4

Methanone, (2,6-dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2,6-dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,6-dimethylphenyl group indicates that the compound has two methyl substituents on the aromatic ring, contributing to its hydrophobic character and potentially influencing its reactivity and solubility. The 3-(1-piperidinylmethyl)phenyl moiety introduces a piperidine ring, which is a six-membered nitrogen-containing heterocycle, adding to the compound's potential biological activity. This compound may exhibit properties typical of both ketones and aromatic amines, such as varying degrees of polarity and the ability to participate in hydrogen bonding. Its specific applications and biological activity would depend on its interaction with biological targets, making it of interest in medicinal chemistry and drug development. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in a laboratory setting.

Formula: C₂₁H₂₅NO

InChI: InChI=1S/C21H25NO/c1-16-8-6-9-17(2)20(16)21(23)19-11-7-10-18(14-19)15-22-12-4-3-5-13-22/h6-11,14H,3-5,12-13,15H2,1-2H3

InChI key: InChIKey=PGVNJKLQEMXADW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=C(C)C=CC=C3C

Synonyms:

• (2,6-Dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• 2,6-Dimethyl-3′-piperidinomethyl benzophenone
• Methanone, (2,6-dimethylphenyl)[3-(1-piperidinylmethyl)phenyl]-

2,6-dimethyl-3′-piperidinomethyl benzophenone

CAS: 898793-17-4

Formula: C₂₁H₂₅NO

Purity: 97.0%

Molecular weight: 307.437

Ref: 10-F204735