CAS 898793-19-6

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(2,3-dimethylphenyl)-

Description:

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(2,3-dimethylphenyl)-, identified by its CAS number 898793-19-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with substituents that include a 3-chloro-5-fluorophenyl group and a 2,3-dimethylphenyl group, contributing to its unique chemical properties. The presence of halogen atoms, such as chlorine and fluorine, typically enhances the compound's reactivity and may influence its biological activity. The dimethyl substitution on the phenyl ring can affect steric hindrance and electronic distribution, impacting the compound's overall stability and reactivity. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's specific physical properties, such as boiling point, melting point, and solubility, would depend on its molecular structure and the interactions between its functional groups. Overall, this compound may have applications in pharmaceuticals or materials science, although detailed studies would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1S/C17H16ClFO/c1-11-4-3-5-13(12(11)2)6-7-17(20)14-8-15(18)10-16(19)9-14/h3-5,8-10H,6-7H2,1-2H3

InChI key: InChIKey=ROPSROXFJKPTLR-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(Cl)=CC(F)=C1)C2=C(C)C(C)=CC=C2

Synonyms:

• 1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(2,3-dimethylphenyl)-

3′-chloro-3-(2,3-dimethylphenyl)-5′-fluoropropiophenone

CAS: 898793-19-6

Formula: C₁₇H₁₆ClFO

Purity: 97.0%

Molecular weight: 290.76

Ref: 10-F206396