CymitQuimica logo

CAS 898793-23-2

:

1-(2,3-dichlorophenyl)-3-(2,3-dimethylphenyl)propan-1-one

Description:
1-(2,3-Dichlorophenyl)-3-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898793-23-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone substituted with two distinct aromatic groups: a dichlorophenyl group and a dimethylphenyl group. The presence of chlorine atoms introduces significant electronegativity, which can influence the compound's reactivity and polarity. The dimethyl substituents on the phenyl ring can affect steric hindrance and electronic properties, potentially impacting its interactions in chemical reactions. This compound may exhibit properties typical of ketones, such as being a liquid at room temperature, with potential applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would need to be determined through experimental data or literature, as they can vary based on the molecular structure and substituents.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-5-3-6-13(12(11)2)9-10-16(20)14-7-4-8-15(18)17(14)19/h3-8H,9-10H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2cccc(c2Cl)Cl)c1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.