CAS 898793-25-4
:1-Propanone, 1-(2,4-dichlorophenyl)-3-(2,3-dimethylphenyl)-
Description:
1-Propanone, 1-(2,4-dichlorophenyl)-3-(2,3-dimethylphenyl)-, also known by its CAS number 898793-25-4, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,4-dichlorophenyl group and a 2,3-dimethylphenyl group. The presence of chlorine atoms in the dichlorophenyl group enhances its reactivity and may influence its physical properties, such as solubility and boiling point. The dimethyl substitution on the second phenyl ring contributes to steric hindrance, potentially affecting the compound's reactivity and interaction with other molecules. Generally, compounds of this type may exhibit properties typical of ketones, including volatility and the ability to participate in various chemical reactions, such as nucleophilic additions. The specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise values, but they can be influenced by the molecular structure and substituents present in the compound.
Formula:C17H16Cl2O
InChI:InChI=1S/C17H16Cl2O/c1-11-4-3-5-13(12(11)2)6-9-17(20)15-8-7-14(18)10-16(15)19/h3-5,7-8,10H,6,9H2,1-2H3
InChI key:InChIKey=GXRPNQHDTTYAOP-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(Cl)C=C(Cl)C=C1)C2=C(C)C(C)=CC=C2
Synonyms:- 1-Propanone, 1-(2,4-dichlorophenyl)-3-(2,3-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.