CAS 898793-27-6

1-Propanone, 1-(2,5-dichlorophenyl)-3-(2,3-dimethylphenyl)-

Description:

1-Propanone, 1-(2,5-dichlorophenyl)-3-(2,3-dimethylphenyl)-, also known by its CAS number 898793-27-6, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a dimethylphenyl group. The presence of chlorine atoms in the dichlorophenyl moiety contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. The dimethylphenyl group adds to the steric bulk and can affect the compound's interactions with other molecules. Generally, compounds of this nature may exhibit properties typical of ketones, including volatility and the ability to participate in various chemical reactions, such as nucleophilic additions. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure of the compound. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₆Cl₂O

InChI: InChI=1S/C17H16Cl2O/c1-11-4-3-5-13(12(11)2)6-9-17(20)15-10-14(18)7-8-16(15)19/h3-5,7-8,10H,6,9H2,1-2H3

InChI key: InChIKey=JUZQZJNRWLBPBA-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C(C)=CC=C1)(=O)C2=C(Cl)C=CC(Cl)=C2

Synonyms:

• 1-Propanone, 1-(2,5-dichlorophenyl)-3-(2,3-dimethylphenyl)-
• 1-(2,5-Dichlorophenyl)-3-(2,3-dimethylphenyl)-1-propanone