CAS 898793-30-1

Methanone, (2-chlorophenyl)[3-(1-piperidinylmethyl)phenyl]-

Description:

Methanone, (2-chlorophenyl)[3-(1-piperidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and a piperidine moiety. The presence of a 2-chlorophenyl group indicates that the compound has a chlorine atom substituted on the phenyl ring, which can influence its reactivity and biological activity. The piperidinylmethyl group suggests that the compound may exhibit properties relevant to medicinal chemistry, potentially interacting with biological targets due to the piperidine's nitrogen atom, which can participate in hydrogen bonding and other interactions. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure implies potential applications in areas such as neuropharmacology or as a precursor in synthetic organic chemistry. However, specific properties such as solubility, melting point, and biological activity would require empirical data for comprehensive characterization.

Formula: C₁₉H₂₀ClNO

InChI: InChI=1S/C19H20ClNO/c20-18-10-3-2-9-17(18)19(22)16-8-6-7-15(13-16)14-21-11-4-1-5-12-21/h2-3,6-10,13H,1,4-5,11-12,14H2

InChI key: InChIKey=GYNNQAIXNPTNME-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCCC2)=CC=C1)C3=C(Cl)C=CC=C3

Synonyms:

• (2-Chlorophenyl)[3-(1-piperidinylmethyl)phenyl]methanone
• 2-Chloro-3′-piperidinomethyl benzophenone
• Methanone, (2-chlorophenyl)[3-(1-piperidinylmethyl)phenyl]-

2-chloro-3′-piperidinomethyl benzophenone

CAS: 898793-30-1

Formula: C₁₉H₂₀ClNO

Purity: 97.0%

Molecular weight: 313.83

Ref: 10-F204741