CAS 898793-31-2
:1-Propanone, 1-(3,5-dichlorophenyl)-3-(2,3-dimethylphenyl)-
Description:
1-Propanone, 1-(3,5-dichlorophenyl)-3-(2,3-dimethylphenyl)-, also known by its CAS number 898793-31-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3,5-dichlorophenyl group and a 2,3-dimethylphenyl group. The presence of chlorine atoms in the phenyl ring contributes to its chemical reactivity and potential biological activity. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can influence its solubility in organic solvents. Additionally, the steric hindrance introduced by the dimethyl groups may affect its reactivity and interactions with biological targets. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and reductions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and applications in fields such as pharmaceuticals or materials science.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-4-3-5-13(12(11)2)6-7-17(20)14-8-15(18)10-16(19)9-14/h3-5,8-10H,6-7H2,1-2H3
InChI key:InChIKey=SPOGHIYVBIEART-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(Cl)=CC(Cl)=C1)C2=C(C)C(C)=CC=C2
Synonyms:- 3′,5′-Dichloro-3-(2,3-dimethylphenyl)propiophenone
- 1-Propanone, 1-(3,5-dichlorophenyl)-3-(2,3-dimethylphenyl)-
- 3',5'-DICHLORO-3-(2,3-DIMETHYLPHENYL)PROPIOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.